betulinic acid


betulinic acid
Links:🕷 ChemSpider
MeSH:Analgesics; Anti-Infective Agents; Anti-Inflammatory Agents, Non-Steroidal; Antineoplastic Agents; Anti-Retroviral Agents; Antiviral Agents; Hormone Antagonists; Hormones, Hormone Substitutes, and Hormone Antagonists; Sensory System Agents
CAS RN:[472-15-1]
Formula:C30H48O3; 456.71 g/mol
InChiKey:QGJZLNKBHJESQX-FZFNOLFKSA-N
SMILES:CC(=C)[C@@H]1CC[C@@]2(CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@@]34C)[C@@H]12)C(O)=O
Molecular structure of betulinic acid
Pharmaceutical use:antitumor
Melting point:297 °C

Isomers

betulinic acid
Molecular structure of betulinic acid
boswellic acid
Molecular structure of boswellic acid
oleanolic acid
Molecular structure of oleanolic acid
testosterone undecanoate
Molecular structure of testosterone undecanoate
ursolic acid
Molecular structure of ursolic acid